Products 2803372-87-2
CAS 2803372-87-2 is the registry number for (1S,2S)-1-Amino-1-(4-fluorophenyl)propan-2-ol hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1S,2S)-1-amino-1-(4-fluorophenyl)propan-2-ol;hydrochloride (CAS 2803372-87-2) is a chemical compound with the molecular formula C9H13ClFNO and a molecular weight of 205.66 g/mol. IUPAC name: (1S,2S)-1-amino-1-(4-fluorophenyl)propan-2-ol;hydrochloride. InChIKey: NCYKLUITXWKQMH-RDNZEXAOSA-N.
| Molecular formula | C9H13ClFNO |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | (1S,2S)-1-amino-1-(4-fluorophenyl)propan-2-ol;hydrochloride |
| InChIKey | NCYKLUITXWKQMH-RDNZEXAOSA-N |
| SMILES | C[C@@H]([C@H](C1=CC=C(C=C1)F)N)O.Cl |
Computed by PubChem (NCBI)