Products 28034-72-2
CAS 28034-72-2 is the registry number for 4’,5’-Didehydro-5’-deoxy thymidine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2R,4S)-4-hydroxy-5-methylideneoxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 28034-72-2) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: 1-[(2R,4S)-4-hydroxy-5-methylideneoxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: GHLYSDYPUZQXIN-JGVFFNPUSA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 1-[(2R,4S)-4-hydroxy-5-methylideneoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | GHLYSDYPUZQXIN-JGVFFNPUSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H](C(=C)O2)O |
Computed by PubChem (NCBI)