Products 2803419-53-4
CAS 2803419-53-4 is the registry number for Edoxaban impurity 62. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 50 mg, 5 mg.
Methyl 3-[methyl-[(2S)-oxetan-2-yl]amino]-4-nitrobenzoate (CAS 2803419-53-4) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: methyl 3-[methyl-[(2S)-oxetan-2-yl]amino]-4-nitrobenzoate. InChIKey: YFUAIBRMXLGTTF-NSHDSACASA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | methyl 3-[methyl-[(2S)-oxetan-2-yl]amino]-4-nitrobenzoate |
| InChIKey | YFUAIBRMXLGTTF-NSHDSACASA-N |
| SMILES | CN([C@@H]1CCO1)C2=C(C=CC(=C2)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)