CAS 2304-96-3 appears in our catalog under these names: Z-Asn-OH, 97%, Z–Asn–OH, Z-L-Asn-OH, Nalpha-Carbobenzoxy-L-asparagine, >99.0%(T), Cbz-Asn-OH 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, TCI, Ambeed. Available pack sizes: 100g, 1kg, 25g, 5g, 500g, 1g, 10g, 1000g.
(2S)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 2304-96-3) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: (2S)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: FUCKRCGERFLLHP-VIFPVBQESA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | (2S)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | FUCKRCGERFLLHP-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)