CAS 4474-86-6 appears in our catalog under these names: Z-D-Asn-OH, 97%, Z–D–Asn–OH, Z-D-Asn-OH, Nalpha-Carbobenzoxy-D-asparagine, >99.0%(T), Cbz-D-Asn-OH 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, TCI, Ambeed. Available pack sizes: 1g, 25g, 100g, 500g, 5g, 100mg, 10g.
(2R)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 4474-86-6) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: (2R)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: FUCKRCGERFLLHP-SECBINFHSA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | (2R)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | FUCKRCGERFLLHP-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)