CAS 50508-33-3 is the registry number for 4-[(4-Nitrophenoxy)acetyl]morpholine, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 1g, 5g.
1-morpholin-4-yl-2-(4-nitrophenoxy)ethanone (CAS 50508-33-3) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: 1-morpholin-4-yl-2-(4-nitrophenoxy)ethanone. InChIKey: HJKRYEJHSXDQRN-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 1-morpholin-4-yl-2-(4-nitrophenoxy)ethanone |
| InChIKey | HJKRYEJHSXDQRN-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)COC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)