CAS 2643-70-1 appears in our catalog under these names: H-Gamma-glu-4-abz-oh, 95%, gamma-Glu-4-Abz-OH. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 100mg.
4-[[(4S)-4-amino-4-carboxybutanoyl]amino]benzoic acid (CAS 2643-70-1) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: 4-[[(4S)-4-amino-4-carboxybutanoyl]amino]benzoic acid. InChIKey: DPRFSOHHKVLCCY-VIFPVBQESA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 4-[[(4S)-4-amino-4-carboxybutanoyl]amino]benzoic acid |
| InChIKey | DPRFSOHHKVLCCY-VIFPVBQESA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NC(=O)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)