CAS 2803460-68-4 appears in our catalog under these names: 5-Bromo-2-((3-chlorobenzyl)oxy)-1,3-dimethylbenzene, 95%, 95%, 5-Bromo-2-((3-chlorobenzyl)oxy)-1,3-dimethylbenzene, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-2-[(3-chlorophenyl)methoxy]-1,3-dimethylbenzene (CAS 2803460-68-4) is a chemical compound with the molecular formula C15H14BrClO and a molecular weight of 325.63 g/mol. IUPAC name: 5-bromo-2-[(3-chlorophenyl)methoxy]-1,3-dimethylbenzene. InChIKey: LSZKZODMMPGWQV-UHFFFAOYSA-N.
| Molecular formula | C15H14BrClO |
|---|---|
| Molecular weight | 325.63 g/mol |
| IUPAC name | 5-bromo-2-[(3-chlorophenyl)methoxy]-1,3-dimethylbenzene |
| InChIKey | LSZKZODMMPGWQV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OCC2=CC(=CC=C2)Cl)C)Br |
Computed by PubChem (NCBI)