CAS 461432-23-5 appears in our catalog under these names: 5-Bromo-2-chloro-4'-ethoxydiphenylmethane, 98%, Dapagliflozin Impurity 50, Dapagliflozin Impurity 15, 4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene, >95% (HPLC), 4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene. Offered by: Chemat, Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g, on request, 100mg.
4-bromo-1-chloro-2-[(4-ethoxyphenyl)methyl]benzene (CAS 461432-23-5) is a chemical compound with the molecular formula C15H14BrClO and a molecular weight of 325.63 g/mol. IUPAC name: 4-bromo-1-chloro-2-[(4-ethoxyphenyl)methyl]benzene. InChIKey: ZUNCHZBITMUSRD-UHFFFAOYSA-N.
| Molecular formula | C15H14BrClO |
|---|---|
| Molecular weight | 325.63 g/mol |
| IUPAC name | 4-bromo-1-chloro-2-[(4-ethoxyphenyl)methyl]benzene |
| InChIKey | ZUNCHZBITMUSRD-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)