Products 2918836-55-0
CAS 2918836-55-0 is the registry number for 5-Bromo-3-chloro-2-isopropoxy-1,1'-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-1-chloro-3-phenyl-2-propan-2-yloxybenzene (CAS 2918836-55-0) is a chemical compound with the molecular formula C15H14BrClO and a molecular weight of 325.63 g/mol. IUPAC name: 5-bromo-1-chloro-3-phenyl-2-propan-2-yloxybenzene. InChIKey: HFYGPLQSASLVSJ-UHFFFAOYSA-N.
| Molecular formula | C15H14BrClO |
|---|---|
| Molecular weight | 325.63 g/mol |
| IUPAC name | 5-bromo-1-chloro-3-phenyl-2-propan-2-yloxybenzene |
| InChIKey | HFYGPLQSASLVSJ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Cl)Br)C2=CC=CC=C2 |
Computed by PubChem (NCBI)