Products 2969326-57-4
CAS 2969326-57-4 is the registry number for 1-bromo-2-((3-chlorobenzyl)oxy)-3,5-dimethylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2-[(3-chlorophenyl)methoxy]-3,5-dimethylbenzene (CAS 2969326-57-4) is a chemical compound with the molecular formula C15H14BrClO and a molecular weight of 325.63 g/mol. IUPAC name: 1-bromo-2-[(3-chlorophenyl)methoxy]-3,5-dimethylbenzene. InChIKey: KQIQKXNLVBFMNB-UHFFFAOYSA-N.
| Molecular formula | C15H14BrClO |
|---|---|
| Molecular weight | 325.63 g/mol |
| IUPAC name | 1-bromo-2-[(3-chlorophenyl)methoxy]-3,5-dimethylbenzene |
| InChIKey | KQIQKXNLVBFMNB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)OCC2=CC(=CC=C2)Cl)C |
Computed by PubChem (NCBI)