Products 280571-30-4
CAS 280571-30-4 is the registry number for S 1360. Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z)-1-[5-[(4-fluorophenyl)methyl]furan-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one (CAS 280571-30-4) is a chemical compound with the molecular formula C16H12FN3O3 and a molecular weight of 313.28 g/mol. IUPAC name: (Z)-1-[5-[(4-fluorophenyl)methyl]furan-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one. InChIKey: HFHDGHOGHWXXDT-ZSOIEALJSA-N.
| Molecular formula | C16H12FN3O3 |
|---|---|
| Molecular weight | 313.28 g/mol |
| IUPAC name | (Z)-1-[5-[(4-fluorophenyl)methyl]furan-2-yl]-3-hydroxy-3-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
| InChIKey | HFHDGHOGHWXXDT-ZSOIEALJSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC=C(O2)C(=O)/C=C(/C3=NC=NN3)\O)F |
Computed by PubChem (NCBI)