Products 2807465-14-9

CAS 2807465-14-9 is the registry number for 2,4,6-Trifluoro-3-isopropoxybenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2,4,6-trifluoro-3-propan-2-yloxybenzoic acid (CAS 2807465-14-9) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 2,4,6-trifluoro-3-propan-2-yloxybenzoic acid. InChIKey: LRIIMMVHJNWRES-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9F3O3
Molecular weight234.17 g/mol
IUPAC name2,4,6-trifluoro-3-propan-2-yloxybenzoic acid
InChIKeyLRIIMMVHJNWRES-UHFFFAOYSA-N
SMILESCC(C)OC1=C(C=C(C(=C1F)C(=O)O)F)F

Computed by PubChem (NCBI)