CAS 2807465-44-5 is the registry number for 6-(Benzyloxy)-2-fluoro-3-methoxybenzoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-fluoro-3-methoxy-6-phenylmethoxybenzoic acid (CAS 2807465-44-5) is a chemical compound with the molecular formula C15H13FO4 and a molecular weight of 276.26 g/mol. IUPAC name: 2-fluoro-3-methoxy-6-phenylmethoxybenzoic acid. InChIKey: SZUDYNPEMASBCM-UHFFFAOYSA-N.
| Molecular formula | C15H13FO4 |
|---|---|
| Molecular weight | 276.26 g/mol |
| IUPAC name | 2-fluoro-3-methoxy-6-phenylmethoxybenzoic acid |
| InChIKey | SZUDYNPEMASBCM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)OCC2=CC=CC=C2)C(=O)O)F |
Computed by PubChem (NCBI)