Products 28081-52-9

CAS 28081-52-9 is the registry number for (3-Methyl-4-oxo-3,4-dihydrophthalazin-1-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-methyl-4-oxophthalazin-1-yl)acetic acid (CAS 28081-52-9) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 2-(3-methyl-4-oxophthalazin-1-yl)acetic acid. InChIKey: FJIQQZXHNOTAEI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O3
Molecular weight218.21 g/mol
IUPAC name2-(3-methyl-4-oxophthalazin-1-yl)acetic acid
InChIKeyFJIQQZXHNOTAEI-UHFFFAOYSA-N
SMILESCN1C(=O)C2=CC=CC=C2C(=N1)CC(=O)O

Computed by PubChem (NCBI)