Products 2810826-16-3
CAS 2810826-16-3 is the registry number for Cyclopropanepropanoic acid, β-cyclopropyl-α-[[(1,1-dimethylethoxy)carbonyl]amino]-, (αR)-, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-3,3-dicyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 2810826-16-3) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: (2R)-3,3-dicyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VRJSPHBNIYAYAY-LLVKDONJSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | (2R)-3,3-dicyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VRJSPHBNIYAYAY-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(C1CC1)C2CC2)C(=O)O |
Computed by PubChem (NCBI)