Products 28122-28-3

CAS 28122-28-3 is the registry number for 1-Benzyl-2,4-dimethylbenzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

1-benzyl-2,4-dimethylbenzene (CAS 28122-28-3) is a chemical compound with the molecular formula C15H16 and a molecular weight of 196.29 g/mol. IUPAC name: 1-benzyl-2,4-dimethylbenzene. InChIKey: CVAMMFFQVDUIEX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16
Molecular weight196.29 g/mol
IUPAC name1-benzyl-2,4-dimethylbenzene
InChIKeyCVAMMFFQVDUIEX-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)CC2=CC=CC=C2)C

Computed by PubChem (NCBI)