CAS 28122-28-3 is the registry number for 1-Benzyl-2,4-dimethylbenzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
1-benzyl-2,4-dimethylbenzene (CAS 28122-28-3) is a chemical compound with the molecular formula C15H16 and a molecular weight of 196.29 g/mol. IUPAC name: 1-benzyl-2,4-dimethylbenzene. InChIKey: CVAMMFFQVDUIEX-UHFFFAOYSA-N.
| Molecular formula | C15H16 |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | 1-benzyl-2,4-dimethylbenzene |
| InChIKey | CVAMMFFQVDUIEX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CC2=CC=CC=C2)C |
Computed by PubChem (NCBI)