CAS 28154-37-2 appears in our catalog under these names: (2S,3S,4S,5R,6R)–6–(Hydroxymethyl)tetrahydro–2H–pyran–2,3,4,5–tetrayl tetraacetate, 1,2,3,4-Tetra-O-acetyl-β-D-mannopyranose, 1,2,3,4-Tetra-O-acetyl-β-D-mannopyranose. Offered by: GLPBio, Chemat, Biosynth. Available pack sizes: 1g, 2g, 500mg, 5g, 250mg, 100mg, 2000mg, 1000mg.
[(2R,3R,4S,5S,6S)-4,5,6-triacetyloxy-2-(hydroxymethyl)oxan-3-yl] acetate (CAS 28154-37-2) is a chemical compound with the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. IUPAC name: [(2R,3R,4S,5S,6S)-4,5,6-triacetyloxy-2-(hydroxymethyl)oxan-3-yl] acetate. InChIKey: FEQXFAYSNRWXDW-PEBLQZBPSA-N.
| Molecular formula | C14H20O10 |
|---|---|
| Molecular weight | 348.30 g/mol |
| IUPAC name | [(2R,3R,4S,5S,6S)-4,5,6-triacetyloxy-2-(hydroxymethyl)oxan-3-yl] acetate |
| InChIKey | FEQXFAYSNRWXDW-PEBLQZBPSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H](O[C@H]([C@H]([C@H]1OC(=O)C)OC(=O)C)OC(=O)C)CO |
Computed by PubChem (NCBI)