Products 51897-82-6
CAS 51897-82-6 is the registry number for 1,2,3,4-Tetraacetate alpha-D-Mannopyranose. Offered by: TRC. Available pack sizes: 25mg.
[(2R,3S,4S,5S)-4,5,6-triacetyloxy-2-(hydroxymethyl)oxan-3-yl] acetate (CAS 51897-82-6) is a chemical compound with the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. IUPAC name: [(2R,3S,4S,5S)-4,5,6-triacetyloxy-2-(hydroxymethyl)oxan-3-yl] acetate. InChIKey: FEQXFAYSNRWXDW-XHVMDGRWSA-N.
| Molecular formula | C14H20O10 |
|---|---|
| Molecular weight | 348.30 g/mol |
| IUPAC name | [(2R,3S,4S,5S)-4,5,6-triacetyloxy-2-(hydroxymethyl)oxan-3-yl] acetate |
| InChIKey | FEQXFAYSNRWXDW-XHVMDGRWSA-N |
| SMILES | CC(=O)O[C@H]1[C@H](OC([C@H]([C@H]1OC(=O)C)OC(=O)C)OC(=O)C)CO |
Computed by PubChem (NCBI)