Products 2818-07-7
CAS 2818-07-7 appears in our catalog under these names: Dimethyl 1H-pyrrole-2,4-dicarboxylate 97%, 1H-Pyrrole-2,4-dicarboxylic acid, 2,4-dimethyl ester, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g, 100mg.
Dimethyl 1H-pyrrole-2,4-dicarboxylate (CAS 2818-07-7) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: dimethyl 1H-pyrrole-2,4-dicarboxylate. InChIKey: QQPMGRCCMQUJJA-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | dimethyl 1H-pyrrole-2,4-dicarboxylate |
| InChIKey | QQPMGRCCMQUJJA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CN1)C(=O)OC |
Computed by PubChem (NCBI)