CAS 2819-56-9 appears in our catalog under these names: 2-Oxo-1-oxaspiro[4.5]decane-4-carboxylic acid, 95%, 2-Oxo-1-oxaspiro(4.5)decane-4-carboxylic acid, 95-<97%, 2–oxo–1–oxaspiro(4·5)decane–4–carboxylic acid, 2-Oxo-1-oxaspiro(4.5)decane-4-carboxylic acid. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 25g, 50g, 100g, 200g.
2-oxo-1-oxaspiro[4.5]decane-4-carboxylic acid (CAS 2819-56-9) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: 2-oxo-1-oxaspiro[4.5]decane-4-carboxylic acid. InChIKey: ZTXZIBLPLHQZAQ-UHFFFAOYSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 2-oxo-1-oxaspiro[4.5]decane-4-carboxylic acid |
| InChIKey | ZTXZIBLPLHQZAQ-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)C(CC(=O)O2)C(=O)O |
Computed by PubChem (NCBI)