CAS 2820101-69-5 appears in our catalog under these names: (S)-2,3-Dihydro-4-methoxy-1H-inden-1-amine hydrochloride, 97%, 97%, (S)-4-Methoxy-2,3-dihydro-1H-inden-1-amine hydrochloride, 95% HPLC. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(1S)-4-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 2820101-69-5) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: (1S)-4-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: LBOFUECRYOJIIZ-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | (1S)-4-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | LBOFUECRYOJIIZ-FVGYRXGTSA-N |
| SMILES | COC1=CC=CC2=C1CC[C@@H]2N.Cl |
Computed by PubChem (NCBI)