CAS 282524-82-7 appears in our catalog under these names: 3-Amino-3-(4-tert-butylphenyl)propanoic acid, 95%, 3-Amino-3-(4-(tert-butyl)phenyl)propanoic acid, 95%, 3-Amino-3-(4-tert-Butylphenyl)propanoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
3-amino-3-(4-tert-butylphenyl)propanoic acid (CAS 282524-82-7) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: 3-amino-3-(4-tert-butylphenyl)propanoic acid. InChIKey: QVTSIUCKEVJNGO-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | 3-amino-3-(4-tert-butylphenyl)propanoic acid |
| InChIKey | QVTSIUCKEVJNGO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(CC(=O)O)N |
Computed by PubChem (NCBI)