Products 2828439-78-5
CAS 2828439-78-5 appears in our catalog under these names: (E)-(2-(3-Ethoxy-3-oxoprop-1-en-1-yl)phenyl)boronic acid, 95%, 95%, (E)-(2-(3-Ethoxy-3-oxoprop-1-en-1-yl)phenyl)boronic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
[2-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]boronic acid (CAS 2828439-78-5) is a chemical compound with the molecular formula C11H13BO4 and a molecular weight of 220.03 g/mol. IUPAC name: [2-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]boronic acid. InChIKey: LBHYMJZBKMSWDG-BQYQJAHWSA-N.
| Molecular formula | C11H13BO4 |
|---|---|
| Molecular weight | 220.03 g/mol |
| IUPAC name | [2-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]boronic acid |
| InChIKey | LBHYMJZBKMSWDG-BQYQJAHWSA-N |
| SMILES | B(C1=CC=CC=C1/C=C/C(=O)OCC)(O)O |
Computed by PubChem (NCBI)