CAS 2828439-90-1 appears in our catalog under these names: (S)-1-(2-(Trifluoromethyl)pyridin-3-yl)ethan-1-amine dihydrochloride, 95% HPLC, (S)-1-(2-(Trifluoromethyl)pyridin-3-yl)ethan-1-amine dihydrochloride, 95% HPLC, 95% HPLC. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 10mg, 25mg, 50mg.
(1S)-1-[2-(trifluoromethyl)-3-pyridinyl]ethanamine;dihydrochloride (CAS 2828439-90-1) is a chemical compound with the molecular formula C8H11Cl2F3N2 and a molecular weight of 263.08 g/mol. IUPAC name: (1S)-1-[2-(trifluoromethyl)-3-pyridinyl]ethanamine;dihydrochloride. InChIKey: KHBLXCMZUMLHBL-XRIGFGBMSA-N.
| Molecular formula | C8H11Cl2F3N2 |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | (1S)-1-[2-(trifluoromethyl)-3-pyridinyl]ethanamine;dihydrochloride |
| InChIKey | KHBLXCMZUMLHBL-XRIGFGBMSA-N |
| SMILES | C[C@@H](C1=C(N=CC=C1)C(F)(F)F)N.Cl.Cl |
Computed by PubChem (NCBI)