Products 2828444-42-2
CAS 2828444-42-2 appears in our catalog under these names: 3-((3-Bromophenyl)amino)piperidine-2,6-dione, 95%, 95%, 3-((3-Bromophenyl)amino)piperidine-2,6-dione, 3-((3-Bromophenyl)amino)piperidine-2,6-dione, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-(3-bromoanilino)piperidine-2,6-dione (CAS 2828444-42-2) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: 3-(3-bromoanilino)piperidine-2,6-dione. InChIKey: UYXSDKSKVXJSSS-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | 3-(3-bromoanilino)piperidine-2,6-dione |
| InChIKey | UYXSDKSKVXJSSS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1NC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)