Products 2838201-37-7
CAS 2838201-37-7 is the registry number for 4-Aminochromane-8-carboxylic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-amino-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride (CAS 2838201-37-7) is a chemical compound with the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. IUPAC name: 4-amino-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride. InChIKey: AILWCNFHUHYGJX-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 4-amino-3,4-dihydro-2H-chromene-8-carboxylic acid;hydrochloride |
| InChIKey | AILWCNFHUHYGJX-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=CC=C2C(=O)O.Cl |
Computed by PubChem (NCBI)