Products 2839192-35-5
CAS 2839192-35-5 is the registry number for Anti-infective agent 6. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(tert-butyliminomethyl)-4-hydroxynaphthalene-1,2-dione (CAS 2839192-35-5) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: 3-(tert-butyliminomethyl)-4-hydroxynaphthalene-1,2-dione. InChIKey: LZMCTOKIXDZZPZ-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 3-(tert-butyliminomethyl)-4-hydroxynaphthalene-1,2-dione |
| InChIKey | LZMCTOKIXDZZPZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N=CC1=C(C2=CC=CC=C2C(=O)C1=O)O |
Computed by PubChem (NCBI)
Synonyms:
Anti-infective agent 6