CAS 284462-78-8 appears in our catalog under these names: 4-(3-Aminophenoxy)-n-methylpyridine-2-carboxamide, 95%, Pirfenidone Impurity 2, 4-(3-Aminophenoxy)-N-methylpyridine-2-carboxamide. Offered by: Combi-blocks, Chemat Brand, Biosynth. Available pack sizes: 250mg, 1g, on request, 0,5g, 50mg.
4-(3-aminophenoxy)-N-methylpyridine-2-carboxamide (CAS 284462-78-8) is a chemical compound with the molecular formula C13H13N3O2 and a molecular weight of 243.26 g/mol. IUPAC name: 4-(3-aminophenoxy)-N-methylpyridine-2-carboxamide. InChIKey: DRPIVJDJDIQRFK-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O2 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 4-(3-aminophenoxy)-N-methylpyridine-2-carboxamide |
| InChIKey | DRPIVJDJDIQRFK-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC=CC(=C2)N |
Computed by PubChem (NCBI)