CAS 284492-14-4 appears in our catalog under these names: Fmoc-3-amino-3-(2-chlorophenyl)-propionic acid, 95%, Fmoc–3–Amino–3–(2–chlorophenyl)–propionic acid, Fmoc-3-amino-3-(2-chlorophenyl)-propionic acid, 97%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
3-(2-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 284492-14-4) is a chemical compound with the molecular formula C24H20ClNO4 and a molecular weight of 421.9 g/mol. IUPAC name: 3-(2-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: MHQMTMDZWLOODM-UHFFFAOYSA-N.
| Molecular formula | C24H20ClNO4 |
|---|---|
| Molecular weight | 421.9 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | MHQMTMDZWLOODM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)