CAS 678991-52-1 appears in our catalog under these names: 2-Chloro-n-fmoc-dl-phenylalanine, 95%, 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2-chlorophenyl)propanoic acid, 95%, 2-Chloro-N-Fmoc-DL-phenylalanine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 25g.
3-(2-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 678991-52-1) is a chemical compound with the molecular formula C24H20ClNO4 and a molecular weight of 421.9 g/mol. IUPAC name: 3-(2-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: RNNKPNPLIMFSDY-UHFFFAOYSA-N.
| Molecular formula | C24H20ClNO4 |
|---|---|
| Molecular weight | 421.9 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | RNNKPNPLIMFSDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)Cl |
Computed by PubChem (NCBI)