CAS 205526-23-4 appears in our catalog under these names: Fmoc-3-chloro-D-phenylalanine, 97%, Fmoc–D–Phe(3–Cl)–OH, Fmoc-D-Phe(3-Cl)-OH, Fmoc-D-Phe(3-Cl)-OH 98%, Fmoc-D-Phe(3-Cl)-OH, 98%, 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 25g, 100g, 5g, 1g.
(2R)-3-(3-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 205526-23-4) is a chemical compound with the molecular formula C24H20ClNO4 and a molecular weight of 421.9 g/mol. IUPAC name: (2R)-3-(3-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: UOZAKKJRIKXQPY-JOCHJYFZSA-N.
| Molecular formula | C24H20ClNO4 |
|---|---|
| Molecular weight | 421.9 g/mol |
| IUPAC name | (2R)-3-(3-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | UOZAKKJRIKXQPY-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC(=CC=C4)Cl)C(=O)O |
Computed by PubChem (NCBI)