CAS 198560-41-7 appears in our catalog under these names: Fmoc–Phe(2–Cl)–OH, Fmoc-L-Phe(2-Cl)-OH, Fmoc-Phe(2-Cl)-OH 95%, Fmoc-Phe(2-Cl)-OH, 97%, 97%, Fmoc-Phe(2-Cl)-OH, 99.14%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 25g, 250mg, 100g, 10g, 25 g, 10 g.
(2S)-3-(2-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 198560-41-7) is a chemical compound with the molecular formula C24H20ClNO4 and a molecular weight of 421.9 g/mol. IUPAC name: (2S)-3-(2-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: RNNKPNPLIMFSDY-QFIPXVFZSA-N.
| Molecular formula | C24H20ClNO4 |
|---|---|
| Molecular weight | 421.9 g/mol |
| IUPAC name | (2S)-3-(2-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | RNNKPNPLIMFSDY-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)Cl |
Computed by PubChem (NCBI)