Products 284492-24-6

CAS 284492-24-6 is the registry number for Boc-beta-3-(furan-3-yl)alanine. Offered by: Iris Biotech. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(furan-3-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 284492-24-6) is a chemical compound with the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. IUPAC name: 3-(furan-3-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: JMRUMNAUPGNUDB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO5
Molecular weight255.27 g/mol
IUPAC name3-(furan-3-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
InChIKeyJMRUMNAUPGNUDB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CC(=O)O)C1=COC=C1

Computed by PubChem (NCBI)