Products 2845095-70-5
CAS 2845095-70-5 is the registry number for (R)-3-(Chloromethyl)-4,6-dimethyl-2-(1-phenylethoxy)pyridine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-(chloromethyl)-4,6-dimethyl-2-[(1R)-1-phenylethoxy]pyridine (CAS 2845095-70-5) is a chemical compound with the molecular formula C16H18ClNO and a molecular weight of 275.77 g/mol. IUPAC name: 3-(chloromethyl)-4,6-dimethyl-2-[(1R)-1-phenylethoxy]pyridine. InChIKey: NMCCOWKCXPUPJB-CYBMUJFWSA-N.
| Molecular formula | C16H18ClNO |
|---|---|
| Molecular weight | 275.77 g/mol |
| IUPAC name | 3-(chloromethyl)-4,6-dimethyl-2-[(1R)-1-phenylethoxy]pyridine |
| InChIKey | NMCCOWKCXPUPJB-CYBMUJFWSA-N |
| SMILES | CC1=CC(=NC(=C1CCl)O[C@H](C)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)