Products 2845127-63-9
CAS 2845127-63-9 is the registry number for Ethyl 8-Cyano-1-ethyl-4-oxo-1,4-dihydroquinoline-3-carboxylate, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl 8-cyano-1-ethyl-4-oxoquinoline-3-carboxylate (CAS 2845127-63-9) is a chemical compound with the molecular formula C15H14N2O3 and a molecular weight of 270.28 g/mol. IUPAC name: ethyl 8-cyano-1-ethyl-4-oxoquinoline-3-carboxylate. InChIKey: IJXZOBNAWMXUJH-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O3 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | ethyl 8-cyano-1-ethyl-4-oxoquinoline-3-carboxylate |
| InChIKey | IJXZOBNAWMXUJH-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CC=CC(=C21)C#N)C(=O)OCC |
Computed by PubChem (NCBI)