Products 2845164-76-1
CAS 2845164-76-1 is the registry number for tert-Butyl (S)-(2-hydroxy-2-(4-hydroxy-3-nitrophenyl)ethyl)carbamate, >97%, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 5g, 10g.
Tert-butyl N-[(2S)-2-hydroxy-2-(4-hydroxy-3-nitrophenyl)ethyl]carbamate (CAS 2845164-76-1) is a chemical compound with the molecular formula C13H18N2O6 and a molecular weight of 298.29 g/mol. IUPAC name: tert-butyl N-[(2S)-2-hydroxy-2-(4-hydroxy-3-nitrophenyl)ethyl]carbamate. InChIKey: VYBSECRGUDIION-LLVKDONJSA-N.
| Molecular formula | C13H18N2O6 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | tert-butyl N-[(2S)-2-hydroxy-2-(4-hydroxy-3-nitrophenyl)ethyl]carbamate |
| InChIKey | VYBSECRGUDIION-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](C1=CC(=C(C=C1)O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)