CAS 2845304-15-4 is the registry number for TERT-BUTYL 6-(2-ACETOXYACETYL)-2,6-DIAZASPIRO[3.3]HEPTANE-2-CARBOXYLATE, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl 6-(2-acetyloxyacetyl)-2,6-diazaspiro[3.3]heptane-2-carboxylate (CAS 2845304-15-4) is a chemical compound with the molecular formula C14H22N2O5 and a molecular weight of 298.33 g/mol. IUPAC name: tert-butyl 6-(2-acetyloxyacetyl)-2,6-diazaspiro[3.3]heptane-2-carboxylate. InChIKey: TWCKHPMMIOOMTP-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O5 |
|---|---|
| Molecular weight | 298.33 g/mol |
| IUPAC name | tert-butyl 6-(2-acetyloxyacetyl)-2,6-diazaspiro[3.3]heptane-2-carboxylate |
| InChIKey | TWCKHPMMIOOMTP-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(=O)N1CC2(C1)CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)