CAS 28458-45-9 appears in our catalog under these names: N-tert-Butyl-2-nitroaniline, 98%, N–(tert–Butyl)–2–nitroaniline, N-tert-Butyl-2-nitroaniline. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 25g, 100g, 5g, 1g.
N-tert-butyl-2-nitroaniline (CAS 28458-45-9) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: N-tert-butyl-2-nitroaniline. InChIKey: HIGVOOQGROZGET-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | N-tert-butyl-2-nitroaniline |
| InChIKey | HIGVOOQGROZGET-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)