Products 284673-18-3
CAS 284673-18-3 appears in our catalog under these names: 1-Benzyl-1,3-benzodiazole-5-carboxylic acid, 98%, 1-Benzyl-1,3-benzodiazole-5-carboxylic acid, 95+%, 1-Benzyl-1,3-benzodiazole-5-carboxylic acid. Offered by: Combi-blocks, Chemat Brand, Biosynth. Available pack sizes: 25g, 1g, 5g, on request, 10g.
1-benzylbenzimidazole-5-carboxylic acid (CAS 284673-18-3) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 1-benzylbenzimidazole-5-carboxylic acid. InChIKey: RBFKLENWRJKDSC-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 1-benzylbenzimidazole-5-carboxylic acid |
| InChIKey | RBFKLENWRJKDSC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NC3=C2C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)