Products 28492-99-1
CAS 28492-99-1 appears in our catalog under these names: 5-Chloro-3H-indol-2-amine hydrochloride, 95%, 5-Chloro-3H-indol-2-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-chloro-3H-indol-2-amine;hydrochloride (CAS 28492-99-1) is a chemical compound with the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. IUPAC name: 5-chloro-3H-indol-2-amine;hydrochloride. InChIKey: KKELQYGKVOUBFD-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2 |
|---|---|
| Molecular weight | 203.07 g/mol |
| IUPAC name | 5-chloro-3H-indol-2-amine;hydrochloride |
| InChIKey | KKELQYGKVOUBFD-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Cl)N=C1N.Cl |
Computed by PubChem (NCBI)