CAS 2851-80-1 is the registry number for 2,7-Dimethyl-9h-fluorene, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.
2,7-dimethyl-9H-fluorene (CAS 2851-80-1) is a chemical compound with the molecular formula C15H14 and a molecular weight of 194.27 g/mol. IUPAC name: 2,7-dimethyl-9H-fluorene. InChIKey: KRPHZIRPXLJJIZ-UHFFFAOYSA-N.
| Molecular formula | C15H14 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | 2,7-dimethyl-9H-fluorene |
| InChIKey | KRPHZIRPXLJJIZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=C(C2)C=C(C=C3)C |
Computed by PubChem (NCBI)