CAS 7495-37-6 is the registry number for 3,6-Dimethyl-fluorene, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg.
3,6-dimethyl-9H-fluorene (CAS 7495-37-6) is a chemical compound with the molecular formula C15H14 and a molecular weight of 194.27 g/mol. IUPAC name: 3,6-dimethyl-9H-fluorene. InChIKey: KKTCFZXZGSLKNV-UHFFFAOYSA-N.
| Molecular formula | C15H14 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | 3,6-dimethyl-9H-fluorene |
| InChIKey | KKTCFZXZGSLKNV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(CC3=C2C=C(C=C3)C)C=C1 |
Computed by PubChem (NCBI)