CAS 34352-84-6 is the registry number for 4-(1-Propen-2-yl)biphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
1-phenyl-4-prop-1-en-2-ylbenzene (CAS 34352-84-6) is a chemical compound with the molecular formula C15H14 and a molecular weight of 194.27 g/mol. IUPAC name: 1-phenyl-4-prop-1-en-2-ylbenzene. InChIKey: STSHXUNZIQVXJL-UHFFFAOYSA-N.
| Molecular formula | C15H14 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | 1-phenyl-4-prop-1-en-2-ylbenzene |
| InChIKey | STSHXUNZIQVXJL-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)