CAS 442-66-0 is the registry number for 1,7-Dimethylfluorene, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
1,7-dimethyl-9H-fluorene (CAS 442-66-0) is a chemical compound with the molecular formula C15H14 and a molecular weight of 194.27 g/mol. IUPAC name: 1,7-dimethyl-9H-fluorene. InChIKey: NHPVHXMCRWRSNW-UHFFFAOYSA-N.
| Molecular formula | C15H14 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | 1,7-dimethyl-9H-fluorene |
| InChIKey | NHPVHXMCRWRSNW-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=CC=CC(=C3C2)C |
Computed by PubChem (NCBI)