Products 285552-82-1

CAS 285552-82-1 is the registry number for 2-(3,4-Dichlorophenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(3,4-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 285552-82-1) is a chemical compound with the molecular formula C15H7Cl2NO4 and a molecular weight of 336.1 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: WQJRCVALNJFUHE-UHFFFAOYSA-N.

Identity
Molecular formulaC15H7Cl2NO4
Molecular weight336.1 g/mol
IUPAC name2-(3,4-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid
InChIKeyWQJRCVALNJFUHE-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1C(=O)O)C(=O)N(C2=O)C3=CC(=C(C=C3)Cl)Cl

Computed by PubChem (NCBI)