CAS 294861-48-6 appears in our catalog under these names: 2-(2,5-Dichlorophenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 2-(2,5-Dichlorophenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(2,5-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 294861-48-6) is a chemical compound with the molecular formula C15H7Cl2NO4 and a molecular weight of 336.1 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: RPULTEWMPQHULS-UHFFFAOYSA-N.
| Molecular formula | C15H7Cl2NO4 |
|---|---|
| Molecular weight | 336.1 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | RPULTEWMPQHULS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C(=O)N(C2=O)C3=C(C=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)