Products 404364-25-6
CAS 404364-25-6 appears in our catalog under these names: 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3,4-dichlorobenzoate, 95%, 95%, 1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl 3,4-dichlorobenzoate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1,3-dioxoisoindol-2-yl) 3,4-dichlorobenzoate (CAS 404364-25-6) is a chemical compound with the molecular formula C15H7Cl2NO4 and a molecular weight of 336.1 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 3,4-dichlorobenzoate. InChIKey: AWUCSAVATCMBBV-UHFFFAOYSA-N.
| Molecular formula | C15H7Cl2NO4 |
|---|---|
| Molecular weight | 336.1 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 3,4-dichlorobenzoate |
| InChIKey | AWUCSAVATCMBBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)OC(=O)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)