CAS 313260-34-3 is the registry number for 2-(2,3-Dichlorophenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2,3-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 313260-34-3) is a chemical compound with the molecular formula C15H7Cl2NO4 and a molecular weight of 336.1 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: NIYITOBHYIPJJI-UHFFFAOYSA-N.
| Molecular formula | C15H7Cl2NO4 |
|---|---|
| Molecular weight | 336.1 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | NIYITOBHYIPJJI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)