CAS 2855938-43-9 is the registry number for Ethyl 7-chloro-6-oxo-5,6-dihydro-1,5-naphthyridine-3-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 7-chloro-6-oxo-5H-1,5-naphthyridine-3-carboxylate (CAS 2855938-43-9) is a chemical compound with the molecular formula C11H9ClN2O3 and a molecular weight of 252.65 g/mol. IUPAC name: ethyl 7-chloro-6-oxo-5H-1,5-naphthyridine-3-carboxylate. InChIKey: SGCMERLXGHHVFB-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O3 |
|---|---|
| Molecular weight | 252.65 g/mol |
| IUPAC name | ethyl 7-chloro-6-oxo-5H-1,5-naphthyridine-3-carboxylate |
| InChIKey | SGCMERLXGHHVFB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C(C(=O)N2)Cl)N=C1 |
Computed by PubChem (NCBI)